C23H22N2O5 — CID 69117368
benzyl (2S)-5-amino-5-oxo-2-[(5-phenylfuran-2-carbonyl)amino]pentanoate (PubChem CID 69117368) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is benzyl (2S)-5-amino-5-oxo-2-[(5-phenylfuran-2-carbonyl)amino]pentanoate.
| Compound Name | benzyl (2S)-5-amino-5-oxo-2-[(5-phenylfuran-2-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 69117368 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | benzyl (2S)-5-amino-5-oxo-2-[(5-phenylfuran-2-carbonyl)amino]pentanoate |
| SMILES | NC(=O)CC[C@H](NC(=O)c1ccc(-c2ccccc2)o1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H22N2O5/c24-21(26)14-11-18(23(28)29-15-16-7-3-1-4-8-16)25-22(27)20-13-12-19(30-20)17-9-5-2-6-10-17/h1-10,12-13,18H,11,14-15H2,(H2,24,26)(H,25,27)/t18-/m0/s1 |
| InChIKey | OMKVQGTWTUNECE-SFHVURJKSA-N |
| XLogP | 3.05 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |