C15H13NO6 — CID 169205444
(2S)-2-[(5-phenylfuran-2-carbonyl)amino]butanedioic acid (PubChem CID 169205444) has the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. Its IUPAC name is (2S)-2-[(5-phenylfuran-2-carbonyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(5-phenylfuran-2-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 169205444 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2S)-2-[(5-phenylfuran-2-carbonyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1ccc(-c2ccccc2)o1)C(=O)O |
| InChI | InChI=1S/C15H13NO6/c17-13(18)8-10(15(20)21)16-14(19)12-7-6-11(22-12)9-4-2-1-3-5-9/h1-7,10H,8H2,(H,16,19)(H,17,18)(H,20,21)/t10-/m0/s1 |
| InChIKey | CQAKRDUPESLELP-JTQLQIEISA-N |
| XLogP | 1.60 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |