C19H21NO5 — CID 119363534
(2R)-2-[[5-(4-acetylphenyl)furan-2-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119363534) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2R)-2-[[5-(4-acetylphenyl)furan-2-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[5-(4-acetylphenyl)furan-2-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119363534 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2R)-2-[[5-(4-acetylphenyl)furan-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)N[C@H](CC(C)C)C(=O)O)o2)cc1 |
| InChI | InChI=1S/C19H21NO5/c1-11(2)10-15(19(23)24)20-18(22)17-9-8-16(25-17)14-6-4-13(5-7-14)12(3)21/h4-9,11,15H,10H2,1-3H3,(H,20,22)(H,23,24)/t15-/m1/s1 |
| InChIKey | ZSFNXJOQUBLWFH-OAHLLOKOSA-N |
| XLogP | 3.38 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |