C16H15NO7 — CID 169205452
(2S)-2-[[5-(2-methoxyphenyl)furan-2-carbonyl]amino]butanedioic acid (PubChem CID 169205452) has the molecular formula C16H15NO7 and a molecular weight of 333.30 g/mol. Its IUPAC name is (2S)-2-[[5-(2-methoxyphenyl)furan-2-carbonyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[5-(2-methoxyphenyl)furan-2-carbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 169205452 |
| Molecular Formula | C16H15NO7 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2S)-2-[[5-(2-methoxyphenyl)furan-2-carbonyl]amino]butanedioic acid |
| SMILES | COc1ccccc1-c1ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)o1 |
| InChI | InChI=1S/C16H15NO7/c1-23-11-5-3-2-4-9(11)12-6-7-13(24-12)15(20)17-10(16(21)22)8-14(18)19/h2-7,10H,8H2,1H3,(H,17,20)(H,18,19)(H,21,22)/t10-/m0/s1 |
| InChIKey | WJALLYLWMWFLJY-JTQLQIEISA-N |
| XLogP | 1.61 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |