C26H24N6O6 — CID 173108252
N-[N'-[[amino-[[5-(2-methoxyphenyl)furan-2-carbonyl]amino]methylidene]amino]carbamimidoyl]-5-(3-methoxyphenyl)furan-2-carboxamide (PubChem CID 173108252) has the molecular formula C26H24N6O6 and a molecular weight of 516.51 g/mol. Its IUPAC name is N-[N'-[[amino-[[5-(2-methoxyphenyl)furan-2-carbonyl]amino]methylidene]amino]carbamimidoyl]-5-(3-methoxyphenyl)furan-2-carboxamide.
| Compound Name | N-[N'-[[amino-[[5-(2-methoxyphenyl)furan-2-carbonyl]amino]methylidene]amino]carbamimidoyl]-5-(3-methoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 173108252 |
| Molecular Formula | C26H24N6O6 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-[N'-[[amino-[[5-(2-methoxyphenyl)furan-2-carbonyl]amino]methylidene]amino]carbamimidoyl]-5-(3-methoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cccc(-c2ccc(C(=O)NC(N)=NN=C(N)NC(=O)c3ccc(-c4ccccc4OC)o3)o2)c1 |
| InChI | InChI=1S/C26H24N6O6/c1-35-16-7-5-6-15(14-16)18-10-12-21(37-18)23(33)29-25(27)31-32-26(28)30-24(34)22-13-11-20(38-22)17-8-3-4-9-19(17)36-2/h3-14H,1-2H3,(H3,27,29,31,33)(H3,28,30,32,34) |
| InChIKey | FJAVLFGCEMPNQP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 179.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|