C19H14F3NO3 — CID 1289408
N-(3-methoxyphenyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 1289408) has the molecular formula C19H14F3NO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1289408 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-(3-methoxyphenyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | COc1cccc(NC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)c1 |
| InChI | InChI=1S/C19H14F3NO3/c1-25-15-7-3-6-14(11-15)23-18(24)17-9-8-16(26-17)12-4-2-5-13(10-12)19(20,21)22/h2-11H,1H3,(H,23,24) |
| InChIKey | YRMOGENQEBKHQY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |