C21H17F3N2O3 — CID 29428114
N-[4-(dimethylcarbamoyl)phenyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 29428114) has the molecular formula C21H17F3N2O3 and a molecular weight of 402.37 g/mol. Its IUPAC name is N-[4-(dimethylcarbamoyl)phenyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(dimethylcarbamoyl)phenyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 29428114 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[4-(dimethylcarbamoyl)phenyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C21H17F3N2O3/c1-26(2)20(28)13-6-8-16(9-7-13)25-19(27)18-11-10-17(29-18)14-4-3-5-15(12-14)21(22,23)24/h3-12H,1-2H3,(H,25,27) |
| InChIKey | LYTBKTXPSKSMJN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |