C18H13F3N2O4S — CID 4789221
N-(3-sulfamoylphenyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 4789221) has the molecular formula C18H13F3N2O4S and a molecular weight of 410.37 g/mol. Its IUPAC name is N-(3-sulfamoylphenyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-(3-sulfamoylphenyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4789221 |
| Molecular Formula | C18H13F3N2O4S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-(3-sulfamoylphenyl)-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)c1 |
| InChI | InChI=1S/C18H13F3N2O4S/c19-18(20,21)12-4-1-3-11(9-12)15-7-8-16(27-15)17(24)23-13-5-2-6-14(10-13)28(22,25)26/h1-10H,(H,23,24)(H2,22,25,26) |
| InChIKey | GQQCDBOZZIVGEB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |