C20H17F3N2O4S — CID 55396044
N-[1-(3-sulfamoylphenyl)ethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 55396044) has the molecular formula C20H17F3N2O4S and a molecular weight of 438.43 g/mol. Its IUPAC name is N-[1-(3-sulfamoylphenyl)ethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[1-(3-sulfamoylphenyl)ethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55396044 |
| Molecular Formula | C20H17F3N2O4S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-[1-(3-sulfamoylphenyl)ethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)o1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H17F3N2O4S/c1-12(13-4-3-7-16(11-13)30(24,27)28)25-19(26)18-9-8-17(29-18)14-5-2-6-15(10-14)20(21,22)23/h2-12H,1H3,(H,25,26)(H2,24,27,28) |
| InChIKey | YURAJNSZTAOUHO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |