C29H26F3N3O4 — CID 11353173
N-[2-[2-(4-methoxyanilino)ethylamino]-2-oxo-1-phenylethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 11353173) has the molecular formula C29H26F3N3O4 and a molecular weight of 537.54 g/mol. Its IUPAC name is N-[2-[2-(4-methoxyanilino)ethylamino]-2-oxo-1-phenylethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-(4-methoxyanilino)ethylamino]-2-oxo-1-phenylethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 11353173 |
| Molecular Formula | C29H26F3N3O4 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-[2-[2-(4-methoxyanilino)ethylamino]-2-oxo-1-phenylethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NCCNC(=O)C(NC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26F3N3O4/c1-38-23-12-10-22(11-13-23)33-16-17-34-28(37)26(19-6-3-2-4-7-19)35-27(36)25-15-14-24(39-25)20-8-5-9-21(18-20)29(30,31)32/h2-15,18,26,33H,16-17H2,1H3,(H,34,37)(H,35,36) |
| InChIKey | LFHDXUFAIIBREM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|