C30H32F3N3O5 — CID 11753419
4-[2-[[(2S)-3-cyclohexyl-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]propanoyl]amino]ethylamino]benzoic acid (PubChem CID 11753419) has the molecular formula C30H32F3N3O5 and a molecular weight of 571.60 g/mol. Its IUPAC name is 4-[2-[[(2S)-3-cyclohexyl-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]propanoyl]amino]ethylamino]benzoic acid.
| Compound Name | 4-[2-[[(2S)-3-cyclohexyl-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]propanoyl]amino]ethylamino]benzoic acid |
|---|---|
| PubChem CID | 11753419 |
| Molecular Formula | C30H32F3N3O5 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 4-[2-[[(2S)-3-cyclohexyl-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]propanoyl]amino]ethylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCCNC(=O)[C@H](CC2CCCCC2)NC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C30H32F3N3O5/c31-30(32,33)22-8-4-7-21(18-22)25-13-14-26(41-25)28(38)36-24(17-19-5-2-1-3-6-19)27(37)35-16-15-34-23-11-9-20(10-12-23)29(39)40/h4,7-14,18-19,24,34H,1-3,5-6,15-17H2,(H,35,37)(H,36,38)(H,39,40)/t24-/m0/s1 |
| InChIKey | UQYZWTMRLNSGRC-DEOSSOPVSA-N |
| XLogP | 5.96 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|