C20H21F3N2O3 — CID 39513052
N-[2-(2-oxoazepan-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 39513052) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[2-(2-oxoazepan-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[2-(2-oxoazepan-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39513052 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[2-(2-oxoazepan-1-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(NCCN1CCCCCC1=O)c1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C20H21F3N2O3/c21-20(22,23)15-6-4-5-14(13-15)16-8-9-17(28-16)19(27)24-10-12-25-11-3-1-2-7-18(25)26/h4-6,8-9,13H,1-3,7,10-12H2,(H,24,27) |
| InChIKey | UUSPPPZBDGJZDD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |