C21H16F3NO4 — CID 59654678
methyl 2-[3-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]phenyl]acetate (PubChem CID 59654678) has the molecular formula C21H16F3NO4 and a molecular weight of 403.36 g/mol. Its IUPAC name is methyl 2-[3-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[3-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 59654678 |
| Molecular Formula | C21H16F3NO4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | methyl 2-[3-[[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(NC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)c1 |
| InChI | InChI=1S/C21H16F3NO4/c1-28-19(26)11-13-4-2-7-16(10-13)25-20(27)18-9-8-17(29-18)14-5-3-6-15(12-14)21(22,23)24/h2-10,12H,11H2,1H3,(H,25,27) |
| InChIKey | BYBXTSMEOHXRPZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |