methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen

C10H9F3N2O2 — CID 175534080

IUPACmethyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen
SMILESCOC(=O)Cc1cccc(C(F)(F)F)c1.N#N
InChIInChI=1S/C10H9F3O2.N2/c1-15-9(14)6-7-3-2-4-8(5-7)10(11,12)13;1-2/h2-5H,6H2,1H3;
InChIKeyQSAKHEWBBXVHFW-UHFFFAOYSA-N
MW246.19 g/mol
LogP2.45
Rot. Bonds2

About methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen

methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen (PubChem CID 175534080) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen.

Molecular Properties

Compound Namemethyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen
PubChem CID175534080
Molecular FormulaC10H9F3N2O2
Molecular Weight246.19 g/mol
Exact Mass246.06
IUPAC Namemethyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen
SMILESCOC(=O)Cc1cccc(C(F)(F)F)c1.N#N
InChIInChI=1S/C10H9F3O2.N2/c1-15-9(14)6-7-3-2-4-8(5-7)10(11,12)13;1-2/h2-5H,6H2,1H3;
InChIKeyQSAKHEWBBXVHFW-UHFFFAOYSA-N
XLogP2.45
TPSA73.88 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.19
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}

Analyze methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen?
The IUPAC name of methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen (CID 175534080) is methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen.
What is the SMILES notation for methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen?
The canonical SMILES for methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen is COC(=O)Cc1cccc(C(F)(F)F)c1.N#N.
What is the InChIKey of methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen?
The InChIKey is QSAKHEWBBXVHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3O2.N2/c1-15-9(14)6-7-3-2-4-8(5-7)10(11,12)13;1-2/h2-5H,6H2,1H3;.
What are the key properties of methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen?
methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen has a molecular weight of 246.19 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(trifluoromethyl)phenyl]acetate;molecular nitrogen is sourced from PubChem (CID 175534080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).