C13H13F3O3 — CID 63900904
methyl 4-oxo-5-[3-(trifluoromethyl)phenyl]pentanoate (PubChem CID 63900904) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is methyl 4-oxo-5-[3-(trifluoromethyl)phenyl]pentanoate.
| Compound Name | methyl 4-oxo-5-[3-(trifluoromethyl)phenyl]pentanoate |
|---|---|
| PubChem CID | 63900904 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | methyl 4-oxo-5-[3-(trifluoromethyl)phenyl]pentanoate |
| SMILES | COC(=O)CCC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3O3/c1-19-12(18)6-5-11(17)8-9-3-2-4-10(7-9)13(14,15)16/h2-4,7H,5-6,8H2,1H3 |
| InChIKey | BFAXCIZKZWTAJR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |