C13H12F3NO — CID 116589424
1-(prop-2-ynylamino)-3-[3-(trifluoromethyl)phenyl]propan-2-one (PubChem CID 116589424) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 1-(prop-2-ynylamino)-3-[3-(trifluoromethyl)phenyl]propan-2-one.
| Compound Name | 1-(prop-2-ynylamino)-3-[3-(trifluoromethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 116589424 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-(prop-2-ynylamino)-3-[3-(trifluoromethyl)phenyl]propan-2-one |
| SMILES | C#CCNCC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3NO/c1-2-6-17-9-12(18)8-10-4-3-5-11(7-10)13(14,15)16/h1,3-5,7,17H,6,8-9H2 |
| InChIKey | CCPGAEYMSJPDLU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|