C21H19F3N2O2 — CID 162222844
N-(2-methylbut-3-yn-2-yl)-4-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]pyridine-2-carboxamide (PubChem CID 162222844) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is N-(2-methylbut-3-yn-2-yl)-4-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]pyridine-2-carboxamide.
| Compound Name | N-(2-methylbut-3-yn-2-yl)-4-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162222844 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-(2-methylbut-3-yn-2-yl)-4-[2-oxo-3-[3-(trifluoromethyl)phenyl]propyl]pyridine-2-carboxamide |
| SMILES | C#CC(C)(C)NC(=O)c1cc(CC(=O)Cc2cccc(C(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-4-20(2,3)26-19(28)18-13-15(8-9-25-18)12-17(27)11-14-6-5-7-16(10-14)21(22,23)24/h1,5-10,13H,11-12H2,2-3H3,(H,26,28) |
| InChIKey | ZUIZYKWFIQIXHI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|