C21H19F3N2O3 — CID 158980903
4-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-oxopropyl]-N-(2-methylbut-3-yn-2-yl)pyridine-2-carboxamide (PubChem CID 158980903) has the molecular formula C21H19F3N2O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-oxopropyl]-N-(2-methylbut-3-yn-2-yl)pyridine-2-carboxamide.
| Compound Name | 4-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-oxopropyl]-N-(2-methylbut-3-yn-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 158980903 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 4-[3-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-oxopropyl]-N-(2-methylbut-3-yn-2-yl)pyridine-2-carboxamide |
| SMILES | C#CC(C)(C)NC(=O)c1cc(CC(=O)Cc2cc(C(F)(F)F)ccc2O)ccn1 |
| InChI | InChI=1S/C21H19F3N2O3/c1-4-20(2,3)26-19(29)17-10-13(7-8-25-17)9-16(27)12-14-11-15(21(22,23)24)5-6-18(14)28/h1,5-8,10-11,28H,9,12H2,2-3H3,(H,26,29) |
| InChIKey | JOZIJXBTGGDPPW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|