C20H18F3N3O3 — CID 139348232
4-[[2-[2-hydroxy-4-(trifluoromethyl)phenyl]acetyl]amino]-N-(2-methylbut-3-yn-2-yl)pyridine-2-carboxamide (PubChem CID 139348232) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is 4-[[2-[2-hydroxy-4-(trifluoromethyl)phenyl]acetyl]amino]-N-(2-methylbut-3-yn-2-yl)pyridine-2-carboxamide.
| Compound Name | 4-[[2-[2-hydroxy-4-(trifluoromethyl)phenyl]acetyl]amino]-N-(2-methylbut-3-yn-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139348232 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 4-[[2-[2-hydroxy-4-(trifluoromethyl)phenyl]acetyl]amino]-N-(2-methylbut-3-yn-2-yl)pyridine-2-carboxamide |
| SMILES | C#CC(C)(C)NC(=O)c1cc(NC(=O)Cc2ccc(C(F)(F)F)cc2O)ccn1 |
| InChI | InChI=1S/C20H18F3N3O3/c1-4-19(2,3)26-18(29)15-11-14(7-8-24-15)25-17(28)9-12-5-6-13(10-16(12)27)20(21,22)23/h1,5-8,10-11,27H,9H2,2-3H3,(H,26,29)(H,24,25,28) |
| InChIKey | YVEJMOJKZHLTOY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|