C15H15F5N2O — CID 90095049
2-(2,2-difluoroethylamino)-N-(2-methylbut-3-yn-2-yl)-5-(trifluoromethyl)benzamide (PubChem CID 90095049) has the molecular formula C15H15F5N2O and a molecular weight of 334.29 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-N-(2-methylbut-3-yn-2-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-(2,2-difluoroethylamino)-N-(2-methylbut-3-yn-2-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90095049 |
| Molecular Formula | C15H15F5N2O |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-N-(2-methylbut-3-yn-2-yl)-5-(trifluoromethyl)benzamide |
| SMILES | C#CC(C)(C)NC(=O)c1cc(C(F)(F)F)ccc1NCC(F)F |
| InChI | InChI=1S/C15H15F5N2O/c1-4-14(2,3)22-13(23)10-7-9(15(18,19)20)5-6-11(10)21-8-12(16)17/h1,5-7,12,21H,8H2,2-3H3,(H,22,23) |
| InChIKey | BMZMCFJFKDGNGI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|