C7H6F3N3O — CID 90455852
4-(trifluoromethyl)pyridine-2-carbohydrazide (PubChem CID 90455852) has the molecular formula C7H6F3N3O and a molecular weight of 205.14 g/mol. Its IUPAC name is 4-(trifluoromethyl)pyridine-2-carbohydrazide.
| Compound Name | 4-(trifluoromethyl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 90455852 |
| Molecular Formula | C7H6F3N3O |
| Molecular Weight | 205.14 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-(trifluoromethyl)pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C7H6F3N3O/c8-7(9,10)4-1-2-12-5(3-4)6(14)13-11/h1-3H,11H2,(H,13,14) |
| InChIKey | LQVMJPVUMXUMRY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|