C9H11F3N4O — CID 63227930
4-hydrazinyl-N-(3,3,3-trifluoropropyl)pyridine-2-carboxamide (PubChem CID 63227930) has the molecular formula C9H11F3N4O and a molecular weight of 248.21 g/mol. Its IUPAC name is 4-hydrazinyl-N-(3,3,3-trifluoropropyl)pyridine-2-carboxamide.
| Compound Name | 4-hydrazinyl-N-(3,3,3-trifluoropropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63227930 |
| Molecular Formula | C9H11F3N4O |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-hydrazinyl-N-(3,3,3-trifluoropropyl)pyridine-2-carboxamide |
| SMILES | NNc1ccnc(C(=O)NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F3N4O/c10-9(11,12)2-4-15-8(17)7-5-6(16-13)1-3-14-7/h1,3,5H,2,4,13H2,(H,14,16)(H,15,17) |
| InChIKey | MOXHBOKEHDUQDD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|