C7H10N4O — CID 43517715
4-hydrazinyl-N-methylpyridine-2-carboxamide (PubChem CID 43517715) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-hydrazinyl-N-methylpyridine-2-carboxamide.
| Compound Name | 4-hydrazinyl-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 43517715 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 4-hydrazinyl-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(NN)ccn1 |
| InChI | InChI=1S/C7H10N4O/c1-9-7(12)6-4-5(11-8)2-3-10-6/h2-4H,8H2,1H3,(H,9,12)(H,10,11) |
| InChIKey | SARMICKRHDSKQU-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|