C12H8F4N4O — CID 107643208
4-hydrazinyl-N-(2,3,5,6-tetrafluorophenyl)pyridine-2-carboxamide (PubChem CID 107643208) has the molecular formula C12H8F4N4O and a molecular weight of 300.22 g/mol. Its IUPAC name is 4-hydrazinyl-N-(2,3,5,6-tetrafluorophenyl)pyridine-2-carboxamide.
| Compound Name | 4-hydrazinyl-N-(2,3,5,6-tetrafluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107643208 |
| Molecular Formula | C12H8F4N4O |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 4-hydrazinyl-N-(2,3,5,6-tetrafluorophenyl)pyridine-2-carboxamide |
| SMILES | NNc1ccnc(C(=O)Nc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C12H8F4N4O/c13-6-4-7(14)10(16)11(9(6)15)19-12(21)8-3-5(20-17)1-2-18-8/h1-4H,17H2,(H,18,20)(H,19,21) |
| InChIKey | UHIFERLGKFFEQC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|