C12H4ClF5N2O — CID 115279672
4-chloro-N-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carboxamide (PubChem CID 115279672) has the molecular formula C12H4ClF5N2O and a molecular weight of 322.62 g/mol. Its IUPAC name is 4-chloro-N-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115279672 |
| Molecular Formula | C12H4ClF5N2O |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 4-chloro-N-(2,3,4,5,6-pentafluorophenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C12H4ClF5N2O/c13-4-1-2-19-5(3-4)12(21)20-11-9(17)7(15)6(14)8(16)10(11)18/h1-3H,(H,20,21) |
| InChIKey | BQVYZOXZAAUFPM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|