C12H6ClF3N2O — CID 30430877
4-chloro-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 30430877) has the molecular formula C12H6ClF3N2O and a molecular weight of 286.64 g/mol. Its IUPAC name is 4-chloro-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 30430877 |
| Molecular Formula | C12H6ClF3N2O |
| Molecular Weight | 286.64 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 4-chloro-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C12H6ClF3N2O/c13-6-3-4-17-9(5-6)12(19)18-8-2-1-7(14)10(15)11(8)16/h1-5H,(H,18,19) |
| InChIKey | JROPCTGJJNUNBQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|