C20H11F3N4O2 — CID 109093370
4-N-(2-cyanophenyl)-2-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109093370) has the molecular formula C20H11F3N4O2 and a molecular weight of 396.33 g/mol. Its IUPAC name is 4-N-(2-cyanophenyl)-2-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(2-cyanophenyl)-2-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109093370 |
| Molecular Formula | C20H11F3N4O2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 4-N-(2-cyanophenyl)-2-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1ccnc(C(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C20H11F3N4O2/c21-13-5-6-15(18(23)17(13)22)27-20(29)16-9-11(7-8-25-16)19(28)26-14-4-2-1-3-12(14)10-24/h1-9H,(H,26,28)(H,27,29) |
| InChIKey | SJWQAHPSKRJBLX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|