C19H11F3N4O — CID 109222708
4-(2-cyanoanilino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 109222708) has the molecular formula C19H11F3N4O and a molecular weight of 368.32 g/mol. Its IUPAC name is 4-(2-cyanoanilino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 4-(2-cyanoanilino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109222708 |
| Molecular Formula | C19H11F3N4O |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-(2-cyanoanilino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | N#Cc1ccccc1Nc1ccnc(C(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C19H11F3N4O/c20-13-5-6-15(18(22)17(13)21)26-19(27)16-9-12(7-8-24-16)25-14-4-2-1-3-11(14)10-23/h1-9H,(H,24,25)(H,26,27) |
| InChIKey | TWOGQZDRVUVNLW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|