C20H13F3N4O — CID 109222061
N-(2-cyanophenyl)-4-[2-(trifluoromethyl)anilino]pyridine-2-carboxamide (PubChem CID 109222061) has the molecular formula C20H13F3N4O and a molecular weight of 382.35 g/mol. Its IUPAC name is N-(2-cyanophenyl)-4-[2-(trifluoromethyl)anilino]pyridine-2-carboxamide.
| Compound Name | N-(2-cyanophenyl)-4-[2-(trifluoromethyl)anilino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109222061 |
| Molecular Formula | C20H13F3N4O |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-(2-cyanophenyl)-4-[2-(trifluoromethyl)anilino]pyridine-2-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1cc(Nc2ccccc2C(F)(F)F)ccn1 |
| InChI | InChI=1S/C20H13F3N4O/c21-20(22,23)15-6-2-4-8-17(15)26-14-9-10-25-18(11-14)19(28)27-16-7-3-1-5-13(16)12-24/h1-11H,(H,25,26)(H,27,28) |
| InChIKey | QXWXFOLJNPWKGG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |