C20H13N5O — CID 109222698
4-(3-cyanoanilino)-N-(2-cyanophenyl)pyridine-2-carboxamide (PubChem CID 109222698) has the molecular formula C20H13N5O and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-(3-cyanoanilino)-N-(2-cyanophenyl)pyridine-2-carboxamide.
| Compound Name | 4-(3-cyanoanilino)-N-(2-cyanophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109222698 |
| Molecular Formula | C20H13N5O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-(3-cyanoanilino)-N-(2-cyanophenyl)pyridine-2-carboxamide |
| SMILES | N#Cc1cccc(Nc2ccnc(C(=O)Nc3ccccc3C#N)c2)c1 |
| InChI | InChI=1S/C20H13N5O/c21-12-14-4-3-6-16(10-14)24-17-8-9-23-19(11-17)20(26)25-18-7-2-1-5-15(18)13-22/h1-11H,(H,23,24)(H,25,26) |
| InChIKey | NNABVZDHXOATJO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |