C21H16F3N3O2 — CID 109086163
2-N-(1-phenylethyl)-4-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109086163) has the molecular formula C21H16F3N3O2 and a molecular weight of 399.37 g/mol. Its IUPAC name is 2-N-(1-phenylethyl)-4-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(1-phenylethyl)-4-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109086163 |
| Molecular Formula | C21H16F3N3O2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-N-(1-phenylethyl)-4-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | CC(NC(=O)c1cc(C(=O)Nc2ccc(F)c(F)c2F)ccn1)c1ccccc1 |
| InChI | InChI=1S/C21H16F3N3O2/c1-12(13-5-3-2-4-6-13)26-21(29)17-11-14(9-10-25-17)20(28)27-16-8-7-15(22)18(23)19(16)24/h2-12H,1H3,(H,26,29)(H,27,28) |
| InChIKey | FNGMBYHZEZMCON-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|