C20H16F3N3O — CID 109210872
4-(1-phenylethylamino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide (PubChem CID 109210872) has the molecular formula C20H16F3N3O and a molecular weight of 371.36 g/mol. Its IUPAC name is 4-(1-phenylethylamino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide.
| Compound Name | 4-(1-phenylethylamino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109210872 |
| Molecular Formula | C20H16F3N3O |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-(1-phenylethylamino)-N-(2,3,4-trifluorophenyl)pyridine-2-carboxamide |
| SMILES | CC(Nc1ccnc(C(=O)Nc2ccc(F)c(F)c2F)c1)c1ccccc1 |
| InChI | InChI=1S/C20H16F3N3O/c1-12(13-5-3-2-4-6-13)25-14-9-10-24-17(11-14)20(27)26-16-8-7-15(21)18(22)19(16)23/h2-12H,1H3,(H,24,25)(H,26,27) |
| InChIKey | CDMBPZLZZMKULY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|