C19H13F3N4O2 — CID 109087202
4-N-(pyridin-2-ylmethyl)-2-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109087202) has the molecular formula C19H13F3N4O2 and a molecular weight of 386.33 g/mol. Its IUPAC name is 4-N-(pyridin-2-ylmethyl)-2-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(pyridin-2-ylmethyl)-2-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109087202 |
| Molecular Formula | C19H13F3N4O2 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 4-N-(pyridin-2-ylmethyl)-2-N-(2,3,4-trifluorophenyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(NCc1ccccn1)c1ccnc(C(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C19H13F3N4O2/c20-13-4-5-14(17(22)16(13)21)26-19(28)15-9-11(6-8-24-15)18(27)25-10-12-3-1-2-7-23-12/h1-9H,10H2,(H,25,27)(H,26,28) |
| InChIKey | SYDBMUUPBFEOJW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|