C9H14N4O — CID 83025450
4-(2,2-dimethylhydrazinyl)-N-methylpyridine-2-carboxamide (PubChem CID 83025450) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-N-methylpyridine-2-carboxamide.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 83025450 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(NN(C)C)ccn1 |
| InChI | InChI=1S/C9H14N4O/c1-10-9(14)8-6-7(4-5-11-8)12-13(2)3/h4-6H,1-3H3,(H,10,14)(H,11,12) |
| InChIKey | JMLNDCQYTUQXFZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|