C14H22N4O2 — CID 60926875
4-[[3-(diethylamino)-3-oxopropyl]amino]-N-methylpyridine-2-carboxamide (PubChem CID 60926875) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-[[3-(diethylamino)-3-oxopropyl]amino]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[[3-(diethylamino)-3-oxopropyl]amino]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 60926875 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-[[3-(diethylamino)-3-oxopropyl]amino]-N-methylpyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)CCNc1ccnc(C(=O)NC)c1 |
| InChI | InChI=1S/C14H22N4O2/c1-4-18(5-2)13(19)7-9-16-11-6-8-17-12(10-11)14(20)15-3/h6,8,10H,4-5,7,9H2,1-3H3,(H,15,20)(H,16,17) |
| InChIKey | BNLYHIIPEZKBRL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |