C13H21N5O2 — CID 79207468
6-[[3-(diethylamino)-3-oxopropyl]amino]-N-methylpyridazine-3-carboxamide (PubChem CID 79207468) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 6-[[3-(diethylamino)-3-oxopropyl]amino]-N-methylpyridazine-3-carboxamide.
| Compound Name | 6-[[3-(diethylamino)-3-oxopropyl]amino]-N-methylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 79207468 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 6-[[3-(diethylamino)-3-oxopropyl]amino]-N-methylpyridazine-3-carboxamide |
| SMILES | CCN(CC)C(=O)CCNc1ccc(C(=O)NC)nn1 |
| InChI | InChI=1S/C13H21N5O2/c1-4-18(5-2)12(19)8-9-15-11-7-6-10(16-17-11)13(20)14-3/h6-7H,4-5,8-9H2,1-3H3,(H,14,20)(H,15,17) |
| InChIKey | GSKPZBHCOOPQLA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |