C11H14F3N3O — CID 62172967
4-(propylamino)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 62172967) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-(propylamino)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 4-(propylamino)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62172967 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-(propylamino)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | CCCNc1ccnc(C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3N3O/c1-2-4-15-8-3-5-16-9(6-8)10(18)17-7-11(12,13)14/h3,5-6H,2,4,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | VPFDUSBKTXLSHH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |