C12H16F3N3O — CID 43517418
N,N-diethyl-4-(2,2,2-trifluoroethylamino)pyridine-2-carboxamide (PubChem CID 43517418) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is N,N-diethyl-4-(2,2,2-trifluoroethylamino)pyridine-2-carboxamide.
| Compound Name | N,N-diethyl-4-(2,2,2-trifluoroethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 43517418 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N,N-diethyl-4-(2,2,2-trifluoroethylamino)pyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NCC(F)(F)F)ccn1 |
| InChI | InChI=1S/C12H16F3N3O/c1-3-18(4-2)11(19)10-7-9(5-6-16-10)17-8-12(13,14)15/h5-7H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | DPYYCLHQXZPFGP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |