C15H21N3O — CID 106222471
N,N-diethyl-4-(pent-4-ynylamino)pyridine-2-carboxamide (PubChem CID 106222471) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N,N-diethyl-4-(pent-4-ynylamino)pyridine-2-carboxamide.
| Compound Name | N,N-diethyl-4-(pent-4-ynylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106222471 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N,N-diethyl-4-(pent-4-ynylamino)pyridine-2-carboxamide |
| SMILES | C#CCCCNc1ccnc(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C15H21N3O/c1-4-7-8-10-16-13-9-11-17-14(12-13)15(19)18(5-2)6-3/h1,9,11-12H,5-8,10H2,2-3H3,(H,16,17) |
| InChIKey | YBKMTBFFSNLDPE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|