C13H21N3O3 — CID 66175860
4-(2,3-dihydroxypropylamino)-N,N-diethylpyridine-2-carboxamide (PubChem CID 66175860) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylamino)-N,N-diethylpyridine-2-carboxamide.
| Compound Name | 4-(2,3-dihydroxypropylamino)-N,N-diethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 66175860 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-(2,3-dihydroxypropylamino)-N,N-diethylpyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NCC(O)CO)ccn1 |
| InChI | InChI=1S/C13H21N3O3/c1-3-16(4-2)13(19)12-7-10(5-6-14-12)15-8-11(18)9-17/h5-7,11,17-18H,3-4,8-9H2,1-2H3,(H,14,15) |
| InChIKey | GNFYRHYMKSQZPM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |