C15H23N3O3 — CID 65226330
2-[[[2-(diethylcarbamoyl)-4-pyridinyl]amino]methyl]butanoic acid (PubChem CID 65226330) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[[[2-(diethylcarbamoyl)-4-pyridinyl]amino]methyl]butanoic acid.
| Compound Name | 2-[[[2-(diethylcarbamoyl)-4-pyridinyl]amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65226330 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-[[[2-(diethylcarbamoyl)-4-pyridinyl]amino]methyl]butanoic acid |
| SMILES | CCC(CNc1ccnc(C(=O)N(CC)CC)c1)C(=O)O |
| InChI | InChI=1S/C15H23N3O3/c1-4-11(15(20)21)10-17-12-7-8-16-13(9-12)14(19)18(5-2)6-3/h7-9,11H,4-6,10H2,1-3H3,(H,16,17)(H,20,21) |
| InChIKey | NKRMKLSHCYZYIH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |