C15H25N3O — CID 62693747
N,N-diethyl-4-(2-methylbutylamino)pyridine-2-carboxamide (PubChem CID 62693747) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is N,N-diethyl-4-(2-methylbutylamino)pyridine-2-carboxamide.
| Compound Name | N,N-diethyl-4-(2-methylbutylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62693747 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N,N-diethyl-4-(2-methylbutylamino)pyridine-2-carboxamide |
| SMILES | CCC(C)CNc1ccnc(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C15H25N3O/c1-5-12(4)11-17-13-8-9-16-14(10-13)15(19)18(6-2)7-3/h8-10,12H,5-7,11H2,1-4H3,(H,16,17) |
| InChIKey | YWPVBSLTEUSKBG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |