C14H9F4N3O3 — CID 164905465
N-(3-fluoro-4-methyl-5-nitrophenyl)-4-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 164905465) has the molecular formula C14H9F4N3O3 and a molecular weight of 343.24 g/mol. Its IUPAC name is N-(3-fluoro-4-methyl-5-nitrophenyl)-4-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(3-fluoro-4-methyl-5-nitrophenyl)-4-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 164905465 |
| Molecular Formula | C14H9F4N3O3 |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-(3-fluoro-4-methyl-5-nitrophenyl)-4-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | Cc1c(F)cc(NC(=O)c2cc(C(F)(F)F)ccn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9F4N3O3/c1-7-10(15)5-9(6-12(7)21(23)24)20-13(22)11-4-8(2-3-19-11)14(16,17)18/h2-6H,1H3,(H,20,22) |
| InChIKey | XAKHOZAUUYQCCN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|