C15H7ClF6N2O3 — CID 34198576
N-[3,5-bis(trifluoromethyl)phenyl]-4-chloro-2-nitrobenzamide (PubChem CID 34198576) has the molecular formula C15H7ClF6N2O3 and a molecular weight of 412.67 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-chloro-2-nitrobenzamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-chloro-2-nitrobenzamide |
|---|---|
| PubChem CID | 34198576 |
| Molecular Formula | C15H7ClF6N2O3 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-chloro-2-nitrobenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H7ClF6N2O3/c16-9-1-2-11(12(6-9)24(26)27)13(25)23-10-4-7(14(17,18)19)3-8(5-10)15(20,21)22/h1-6H,(H,23,25) |
| InChIKey | WOQBGZGGXPOBTF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|