C14H7ClF3N3O5 — CID 3111250
N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitrobenzamide (PubChem CID 3111250) has the molecular formula C14H7ClF3N3O5 and a molecular weight of 389.67 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitrobenzamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 3111250 |
| Molecular Formula | C14H7ClF3N3O5 |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2,4-dinitrobenzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7ClF3N3O5/c15-10-4-1-7(14(16,17)18)5-11(10)19-13(22)9-3-2-8(20(23)24)6-12(9)21(25)26/h1-6H,(H,19,22) |
| InChIKey | QVPMXMGYLYFCJA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|