C16H8Cl2F4N4O6 — CID 3519654
N,N'-bis(2-chloro-5-nitrophenyl)-2,2,3,3-tetrafluorobutanediamide (PubChem CID 3519654) has the molecular formula C16H8Cl2F4N4O6 and a molecular weight of 499.16 g/mol. Its IUPAC name is N,N'-bis(2-chloro-5-nitrophenyl)-2,2,3,3-tetrafluorobutanediamide.
| Compound Name | N,N'-bis(2-chloro-5-nitrophenyl)-2,2,3,3-tetrafluorobutanediamide |
|---|---|
| PubChem CID | 3519654 |
| Molecular Formula | C16H8Cl2F4N4O6 |
| Molecular Weight | 499.16 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | N,N'-bis(2-chloro-5-nitrophenyl)-2,2,3,3-tetrafluorobutanediamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)C(F)(F)C(F)(F)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H8Cl2F4N4O6/c17-9-3-1-7(25(29)30)5-11(9)23-13(27)15(19,20)16(21,22)14(28)24-12-6-8(26(31)32)2-4-10(12)18/h1-6H,(H,23,27)(H,24,28) |
| InChIKey | CYFUPFQNHMQABS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|