C11H4ClF9N2O3 — CID 3632427
N-(2-chloro-4-nitrophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 3632427) has the molecular formula C11H4ClF9N2O3 and a molecular weight of 418.60 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 3632427 |
| Molecular Formula | C11H4ClF9N2O3 |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H4ClF9N2O3/c12-5-3-4(23(25)26)1-2-6(5)22-7(24)8(13,14)9(15,16)10(17,18)11(19,20)21/h1-3H,(H,22,24) |
| InChIKey | ZZJBQRZXOUZYIZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|