C16H5F18N3O4 — CID 4092045
2,2,3,3,4,4,5,5,5-nonafluoro-N-[4-nitro-3-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]pentanamide (PubChem CID 4092045) has the molecular formula C16H5F18N3O4 and a molecular weight of 645.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-[4-nitro-3-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-[4-nitro-3-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 4092045 |
| Molecular Formula | C16H5F18N3O4 |
| Molecular Weight | 645.20 g/mol |
| Exact Mass | 645.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-[4-nitro-3-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]pentanamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H5F18N3O4/c17-9(18,11(21,22)13(25,26)15(29,30)31)7(38)35-4-1-2-6(37(40)41)5(3-4)36-8(39)10(19,20)12(23,24)14(27,28)16(32,33)34/h1-3H,(H,35,38)(H,36,39) |
| InChIKey | QSBZZVQHJGTIEX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.20 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|