C16H6F18N2O2 — CID 4077005
2,2,3,3,4,4,5,5,5-nonafluoro-N-[2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]pentanamide (PubChem CID 4077005) has the molecular formula C16H6F18N2O2 and a molecular weight of 600.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-[2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-[2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 4077005 |
| Molecular Formula | C16H6F18N2O2 |
| Molecular Weight | 600.20 g/mol |
| Exact Mass | 600.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-[2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)phenyl]pentanamide |
| SMILES | O=C(Nc1ccccc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H6F18N2O2/c17-9(18,11(21,22)13(25,26)15(29,30)31)7(37)35-5-3-1-2-4-6(5)36-8(38)10(19,20)12(23,24)14(27,28)16(32,33)34/h1-4H,(H,35,37)(H,36,38) |
| InChIKey | ZVYRAOBPZVMUGM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.20 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|