C17H7F15N2O — CID 15164362
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-quinolin-8-yloctanamide (PubChem CID 15164362) has the molecular formula C17H7F15N2O and a molecular weight of 540.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-quinolin-8-yloctanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-quinolin-8-yloctanamide |
|---|---|
| PubChem CID | 15164362 |
| Molecular Formula | C17H7F15N2O |
| Molecular Weight | 540.23 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-quinolin-8-yloctanamide |
| SMILES | O=C(Nc1cccc2cccnc12)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H7F15N2O/c18-11(19,10(35)34-8-5-1-3-7-4-2-6-33-9(7)8)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)32/h1-6H,(H,34,35) |
| InChIKey | KLBPYHQTYZNGRH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.23 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|